C32H39ClN2O5 — CID 139476852
(19R,22R,23S,24E)-10-chloro-23-hydroxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylic acid (PubChem CID 139476852) has the molecular formula C32H39ClN2O5 and a molecular weight of 567.13 g/mol. Its IUPAC name is (19R,22R,23S,24E)-10-chloro-23-hydroxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylic acid.
| Compound Name | (19R,22R,23S,24E)-10-chloro-23-hydroxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylic acid |
|---|---|
| PubChem CID | 139476852 |
| Molecular Formula | C32H39ClN2O5 |
| Molecular Weight | 567.13 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | (19R,22R,23S,24E)-10-chloro-23-hydroxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylic acid |
| SMILES | CN1CC/C=C\[C@H](O)[C@@H]2CC[C@H]2CN2CCCCc3cc(Cl)ccc3COc3ccc(cc32)C(C(=O)O)CC1=O |
| InChI | InChI=1S/C32H39ClN2O5/c1-34-14-4-3-7-29(36)26-12-9-23(26)19-35-15-5-2-6-21-16-25(33)11-8-24(21)20-40-30-13-10-22(17-28(30)35)27(32(38)39)18-31(34)37/h3,7-8,10-11,13,16-17,23,26-27,29,36H,2,4-6,9,12,14-15,18-20H2,1H3,(H,38,39)/b7-3-/t23-,26+,27?,29-/m0/s1 |
| InChIKey | YUIGJLCEFQROOJ-XDNPMDBVSA-N |
| XLogP | 5.43 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.13 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|