C34H43ClN2O5 — CID 153341115
methyl (19R,22R,23S,24E,31R)-10-chloro-23-methoxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate (PubChem CID 153341115) has the molecular formula C34H43ClN2O5 and a molecular weight of 595.18 g/mol. Its IUPAC name is methyl (19R,22R,23S,24E,31R)-10-chloro-23-methoxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate.
| Compound Name | methyl (19R,22R,23S,24E,31R)-10-chloro-23-methoxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate |
|---|---|
| PubChem CID | 153341115 |
| Molecular Formula | C34H43ClN2O5 |
| Molecular Weight | 595.18 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | methyl (19R,22R,23S,24E,31R)-10-chloro-23-methoxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(=O)N(C)CC/C=C\[C@H](OC)[C@@H]2CC[C@H]2CN2CCCCc3cc(Cl)ccc3COc3ccc1cc32 |
| InChI | InChI=1S/C34H43ClN2O5/c1-36-16-6-5-9-31(40-2)28-14-11-25(28)21-37-17-7-4-8-23-18-27(35)13-10-26(23)22-42-32-15-12-24(19-30(32)37)29(20-33(36)38)34(39)41-3/h5,9-10,12-13,15,18-19,25,28-29,31H,4,6-8,11,14,16-17,20-22H2,1-3H3/b9-5-/t25-,28+,29+,31-/m0/s1 |
| InChIKey | OXWJGUOAMLKLEI-DITNRKNJSA-N |
| XLogP | 6.17 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.18 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|