C29H33ClN2O5 — CID 153341108
(5E,11S,18S)-7'-chloro-11-hydroxy-8-methyl-9-oxospiro[16-oxa-1,8-diazatricyclo[10.7.2.015,20]henicosa-5,12(21),13,15(20)-tetraene-18,4'-2,3-dihydro-1H-naphthalene]-11-carboxylic acid (PubChem CID 153341108) has the molecular formula C29H33ClN2O5 and a molecular weight of 525.05 g/mol. Its IUPAC name is (5E,11S,18S)-7'-chloro-11-hydroxy-8-methyl-9-oxospiro[16-oxa-1,8-diazatricyclo[10.7.2.015,20]henicosa-5,12(21),13,15(20)-tetraene-18,4'-2,3-dihydro-1H-naphthalene]-11-carboxylic acid.
| Compound Name | (5E,11S,18S)-7'-chloro-11-hydroxy-8-methyl-9-oxospiro[16-oxa-1,8-diazatricyclo[10.7.2.015,20]henicosa-5,12(21),13,15(20)-tetraene-18,4'-2,3-dihydro-1H-naphthalene]-11-carboxylic acid |
|---|---|
| PubChem CID | 153341108 |
| Molecular Formula | C29H33ClN2O5 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | (5E,11S,18S)-7'-chloro-11-hydroxy-8-methyl-9-oxospiro[16-oxa-1,8-diazatricyclo[10.7.2.015,20]henicosa-5,12(21),13,15(20)-tetraene-18,4'-2,3-dihydro-1H-naphthalene]-11-carboxylic acid |
| SMILES | CN1C/C=C/CCCN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc(cc32)[C@](O)(C(=O)O)CC1=O |
| InChI | InChI=1S/C29H33ClN2O5/c1-31-13-4-2-3-5-14-32-18-28(12-6-7-20-15-22(30)9-10-23(20)28)19-37-25-11-8-21(16-24(25)32)29(36,27(34)35)17-26(31)33/h2,4,8-11,15-16,36H,3,5-7,12-14,17-19H2,1H3,(H,34,35)/b4-2+/t28-,29-/m0/s1 |
| InChIKey | WUDHHMCLNBTRTO-NZMLKKLBSA-N |
| XLogP | 4.28 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|