C30H37ClN2O3 — CID 156622636
(6E,11R,12S,19S)-7'-chloro-12-hydroxy-9,11-dimethylspiro[17-oxa-1,9-diazatricyclo[11.7.2.016,21]docosa-6,13(22),14,16(21)-tetraene-19,4'-2,3-dihydro-1H-naphthalene]-10-one (PubChem CID 156622636) has the molecular formula C30H37ClN2O3 and a molecular weight of 509.09 g/mol. Its IUPAC name is (6E,11R,12S,19S)-7'-chloro-12-hydroxy-9,11-dimethylspiro[17-oxa-1,9-diazatricyclo[11.7.2.016,21]docosa-6,13(22),14,16(21)-tetraene-19,4'-2,3-dihydro-1H-naphthalene]-10-one.
| Compound Name | (6E,11R,12S,19S)-7'-chloro-12-hydroxy-9,11-dimethylspiro[17-oxa-1,9-diazatricyclo[11.7.2.016,21]docosa-6,13(22),14,16(21)-tetraene-19,4'-2,3-dihydro-1H-naphthalene]-10-one |
|---|---|
| PubChem CID | 156622636 |
| Molecular Formula | C30H37ClN2O3 |
| Molecular Weight | 509.09 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | (6E,11R,12S,19S)-7'-chloro-12-hydroxy-9,11-dimethylspiro[17-oxa-1,9-diazatricyclo[11.7.2.016,21]docosa-6,13(22),14,16(21)-tetraene-19,4'-2,3-dihydro-1H-naphthalene]-10-one |
| SMILES | C[C@H]1C(=O)N(C)C/C=C\CCCCN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc(cc32)[C@H]1O |
| InChI | InChI=1S/C30H37ClN2O3/c1-21-28(34)23-10-13-27-26(18-23)33(16-7-5-3-4-6-15-32(2)29(21)35)19-30(20-36-27)14-8-9-22-17-24(31)11-12-25(22)30/h4,6,10-13,17-18,21,28,34H,3,5,7-9,14-16,19-20H2,1-2H3/b6-4-/t21-,28+,30+/m1/s1 |
| InChIKey | WFCVSPYXHOZIDG-RORAAZSCSA-N |
| XLogP | 5.68 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.09 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|