C31H39ClN2O4 — CID 156622414
(6E,13R,20S)-7'-chloro-13-hydroxy-13-(hydroxymethyl)-10-methylspiro[18-oxa-1,10-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-11-one (PubChem CID 156622414) has the molecular formula C31H39ClN2O4 and a molecular weight of 539.12 g/mol. Its IUPAC name is (6E,13R,20S)-7'-chloro-13-hydroxy-13-(hydroxymethyl)-10-methylspiro[18-oxa-1,10-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-11-one.
| Compound Name | (6E,13R,20S)-7'-chloro-13-hydroxy-13-(hydroxymethyl)-10-methylspiro[18-oxa-1,10-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-11-one |
|---|---|
| PubChem CID | 156622414 |
| Molecular Formula | C31H39ClN2O4 |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | (6E,13R,20S)-7'-chloro-13-hydroxy-13-(hydroxymethyl)-10-methylspiro[18-oxa-1,10-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-11-one |
| SMILES | CN1CC/C=C\CCCCN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc(cc32)[C@@](O)(CO)CC1=O |
| InChI | InChI=1S/C31H39ClN2O4/c1-33-15-6-4-2-3-5-7-16-34-20-30(14-8-9-23-17-25(32)11-12-26(23)30)22-38-28-13-10-24(18-27(28)34)31(37,21-35)19-29(33)36/h2,4,10-13,17-18,35,37H,3,5-9,14-16,19-22H2,1H3/b4-2-/t30-,31-/m0/s1 |
| InChIKey | PAYQXVCKUOUSQZ-PXPRLXEXSA-N |
| XLogP | 4.97 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|