C32H39ClN2O5 — CID 153341224
(7E,12S,13S,20S)-7'-chloro-13-hydroxy-10,12-dimethyl-11-oxospiro[18-oxa-1,10-diazatricyclo[12.7.2.017,22]tricosa-7,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-13-carboxylic acid (PubChem CID 153341224) has the molecular formula C32H39ClN2O5 and a molecular weight of 567.13 g/mol. Its IUPAC name is (7E,12S,13S,20S)-7'-chloro-13-hydroxy-10,12-dimethyl-11-oxospiro[18-oxa-1,10-diazatricyclo[12.7.2.017,22]tricosa-7,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-13-carboxylic acid.
| Compound Name | (7E,12S,13S,20S)-7'-chloro-13-hydroxy-10,12-dimethyl-11-oxospiro[18-oxa-1,10-diazatricyclo[12.7.2.017,22]tricosa-7,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-13-carboxylic acid |
|---|---|
| PubChem CID | 153341224 |
| Molecular Formula | C32H39ClN2O5 |
| Molecular Weight | 567.13 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | (7E,12S,13S,20S)-7'-chloro-13-hydroxy-10,12-dimethyl-11-oxospiro[18-oxa-1,10-diazatricyclo[12.7.2.017,22]tricosa-7,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-13-carboxylic acid |
| SMILES | C[C@@H]1C(=O)N(C)C/C=C/CCCCCN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc(cc32)[C@]1(O)C(=O)O |
| InChI | InChI=1S/C32H39ClN2O5/c1-22-29(36)34(2)16-7-5-3-4-6-8-17-35-20-31(15-9-10-23-18-25(33)12-13-26(23)31)21-40-28-14-11-24(19-27(28)35)32(22,39)30(37)38/h5,7,11-14,18-19,22,39H,3-4,6,8-10,15-17,20-21H2,1-2H3,(H,37,38)/b7-5+/t22-,31+,32+/m1/s1 |
| InChIKey | CWIQKJPXAMJOLC-AXFKOHJFSA-N |
| XLogP | 5.31 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.13 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|