About 2-ethylpentyl 2-methylbutan-2-yl carbonate
2-ethylpentyl 2-methylbutan-2-yl carbonate (PubChem CID 139479516) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-ethylpentyl 2-methylbutan-2-yl carbonate.
Molecular Properties
| Compound Name | 2-ethylpentyl 2-methylbutan-2-yl carbonate |
| PubChem CID | 139479516 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 2-ethylpentyl 2-methylbutan-2-yl carbonate |
| SMILES | CCCC(CC)COC(=O)OC(C)(C)CC |
| InChI | InChI=1S/C13H26O3/c1-6-9-11(7-2)10-15-12(14)16-13(4,5)8-3/h11H,6-10H2,1-5H3 |
| InChIKey | SWJIICSQANTKAB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylpentyl 2-methylbutan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpentyl 2-methylbutan-2-yl carbonate?
The IUPAC name of 2-ethylpentyl 2-methylbutan-2-yl carbonate (CID 139479516) is 2-ethylpentyl 2-methylbutan-2-yl carbonate.
What is the SMILES notation for 2-ethylpentyl 2-methylbutan-2-yl carbonate?
The canonical SMILES for 2-ethylpentyl 2-methylbutan-2-yl carbonate is CCCC(CC)COC(=O)OC(C)(C)CC.
What is the InChIKey of 2-ethylpentyl 2-methylbutan-2-yl carbonate?
The InChIKey is SWJIICSQANTKAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3/c1-6-9-11(7-2)10-15-12(14)16-13(4,5)8-3/h11H,6-10H2,1-5H3.
What are the key properties of 2-ethylpentyl 2-methylbutan-2-yl carbonate?
2-ethylpentyl 2-methylbutan-2-yl carbonate has a molecular weight of 230.35 g/mol, XLogP of 4.15, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpentyl 2-methylbutan-2-yl carbonate is sourced from PubChem (CID 139479516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).