C11H21F2N3 — CID 139480575
(1Z)-2-[amino(propan-2-yl)amino]-8,8-difluorocycloocten-1-amine (PubChem CID 139480575) has the molecular formula C11H21F2N3 and a molecular weight of 233.31 g/mol. Its IUPAC name is (1Z)-2-[amino(propan-2-yl)amino]-8,8-difluorocycloocten-1-amine.
| Compound Name | (1Z)-2-[amino(propan-2-yl)amino]-8,8-difluorocycloocten-1-amine |
|---|---|
| PubChem CID | 139480575 |
| Molecular Formula | C11H21F2N3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | (1Z)-2-[amino(propan-2-yl)amino]-8,8-difluorocycloocten-1-amine |
| SMILES | CC(C)N(N)/C1=C(\N)C(F)(F)CCCCC1 |
| InChI | InChI=1S/C11H21F2N3/c1-8(2)16(15)9-6-4-3-5-7-11(12,13)10(9)14/h8H,3-7,14-15H2,1-2H3/b10-9- |
| InChIKey | RCGWEAQYPHJKGF-KTKRTIGZSA-N |
| XLogP | 2.34 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|