C13H27F2N3 — CID 145278390
(1Z)-2-[amino(methyl)amino]-5-ethyl-8,8-difluorocycloocten-1-amine;ethane (PubChem CID 145278390) has the molecular formula C13H27F2N3 and a molecular weight of 263.38 g/mol. Its IUPAC name is (1Z)-2-[amino(methyl)amino]-5-ethyl-8,8-difluorocycloocten-1-amine;ethane.
| Compound Name | (1Z)-2-[amino(methyl)amino]-5-ethyl-8,8-difluorocycloocten-1-amine;ethane |
|---|---|
| PubChem CID | 145278390 |
| Molecular Formula | C13H27F2N3 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | (1Z)-2-[amino(methyl)amino]-5-ethyl-8,8-difluorocycloocten-1-amine;ethane |
| SMILES | CC.CCC1CC/C(N(C)N)=C(/N)C(F)(F)CC1 |
| InChI | InChI=1S/C11H21F2N3.C2H6/c1-3-8-4-5-9(16(2)15)10(14)11(12,13)7-6-8;1-2/h8H,3-7,14-15H2,1-2H3;1-2H3/b10-9-; |
| InChIKey | OJQVWYWVRMZXON-KVVVOXFISA-N |
| XLogP | 3.22 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|