C10H19F2N3 — CID 145278393
(1Z)-2-[amino(methyl)amino]-8,8-difluoro-5-methylcycloocten-1-amine (PubChem CID 145278393) has the molecular formula C10H19F2N3 and a molecular weight of 219.28 g/mol. Its IUPAC name is (1Z)-2-[amino(methyl)amino]-8,8-difluoro-5-methylcycloocten-1-amine.
| Compound Name | (1Z)-2-[amino(methyl)amino]-8,8-difluoro-5-methylcycloocten-1-amine |
|---|---|
| PubChem CID | 145278393 |
| Molecular Formula | C10H19F2N3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | (1Z)-2-[amino(methyl)amino]-8,8-difluoro-5-methylcycloocten-1-amine |
| SMILES | CC1CC/C(N(C)N)=C(/N)C(F)(F)CC1 |
| InChI | InChI=1S/C10H19F2N3/c1-7-3-4-8(15(2)14)9(13)10(11,12)6-5-7/h7H,3-6,13-14H2,1-2H3/b9-8- |
| InChIKey | VBGIONDFUUPBRV-HJWRWDBZSA-N |
| XLogP | 1.81 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|