C9H18F2N4 — CID 177230257
(1Z)-2-N,2-N-diamino-3,3-difluoro-6-methylcyclooctene-1,2-diamine (PubChem CID 177230257) has the molecular formula C9H18F2N4 and a molecular weight of 220.27 g/mol. Its IUPAC name is (1Z)-2-N,2-N-diamino-3,3-difluoro-6-methylcyclooctene-1,2-diamine.
| Compound Name | (1Z)-2-N,2-N-diamino-3,3-difluoro-6-methylcyclooctene-1,2-diamine |
|---|---|
| PubChem CID | 177230257 |
| Molecular Formula | C9H18F2N4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (1Z)-2-N,2-N-diamino-3,3-difluoro-6-methylcyclooctene-1,2-diamine |
| SMILES | CC1CC/C(N)=C(/N(N)N)C(F)(F)CC1 |
| InChI | InChI=1S/C9H18F2N4/c1-6-2-3-7(12)8(15(13)14)9(10,11)5-4-6/h6H,2-5,12-14H2,1H3/b8-7- |
| InChIKey | SMAUSLJZCCXBKJ-FPLPWBNLSA-N |
| XLogP | 1.05 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|