C11H22F2N2 — CID 155745414
(1Z)-3,3-difluoro-4-methylcyclooctene-1,2-diamine;ethane (PubChem CID 155745414) has the molecular formula C11H22F2N2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (1Z)-3,3-difluoro-4-methylcyclooctene-1,2-diamine;ethane.
| Compound Name | (1Z)-3,3-difluoro-4-methylcyclooctene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 155745414 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (1Z)-3,3-difluoro-4-methylcyclooctene-1,2-diamine;ethane |
| SMILES | CC.CC1CCCC/C(N)=C(/N)C1(F)F |
| InChI | InChI=1S/C9H16F2N2.C2H6/c1-6-4-2-3-5-7(12)8(13)9(6,10)11;1-2/h6H,2-5,12-13H2,1H3;1-2H3/b8-7-; |
| InChIKey | YXAMEGXBTKJSTC-CFYXSCKTSA-N |
| XLogP | 2.99 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |