C10H18F2N2 — CID 155745232
(1Z)-3,3-difluoro-1-N,4-dimethylcyclooctene-1,2-diamine (PubChem CID 155745232) has the molecular formula C10H18F2N2 and a molecular weight of 204.26 g/mol. Its IUPAC name is (1Z)-3,3-difluoro-1-N,4-dimethylcyclooctene-1,2-diamine.
| Compound Name | (1Z)-3,3-difluoro-1-N,4-dimethylcyclooctene-1,2-diamine |
|---|---|
| PubChem CID | 155745232 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (1Z)-3,3-difluoro-1-N,4-dimethylcyclooctene-1,2-diamine |
| SMILES | CN/C1=C(\N)C(F)(F)C(C)CCCC1 |
| InChI | InChI=1S/C10H18F2N2/c1-7-5-3-4-6-8(14-2)9(13)10(7,11)12/h7,14H,3-6,13H2,1-2H3/b9-8- |
| InChIKey | GLPFRKZXSYUFDR-HJWRWDBZSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |