C31H30Cl2F2N4O3 — CID 139482971
(2R,3S,4R,5S)-N-(4-carbamoyl-2-methoxyphenyl)-3,4-bis(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide (PubChem CID 139482971) has the molecular formula C31H30Cl2F2N4O3 and a molecular weight of 615.51 g/mol. Its IUPAC name is (2R,3S,4R,5S)-N-(4-carbamoyl-2-methoxyphenyl)-3,4-bis(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-N-(4-carbamoyl-2-methoxyphenyl)-3,4-bis(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139482971 |
| Molecular Formula | C31H30Cl2F2N4O3 |
| Molecular Weight | 615.51 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | (2R,3S,4R,5S)-N-(4-carbamoyl-2-methoxyphenyl)-3,4-bis(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
| SMILES | COc1cc(C(N)=O)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@](C#N)(c2ccc(Cl)cc2F)[C@H]1c1ccc(Cl)cc1F |
| InChI | InChI=1S/C31H30Cl2F2N4O3/c1-30(2,3)14-25-31(15-36,20-9-7-18(33)13-22(20)35)26(19-8-6-17(32)12-21(19)34)27(39-25)29(41)38-23-10-5-16(28(37)40)11-24(23)42-4/h5-13,25-27,39H,14H2,1-4H3,(H2,37,40)(H,38,41)/t25-,26-,27+,31-/m0/s1 |
| InChIKey | GHGSRBIYHXIJDT-QZIGDIDDSA-N |
| XLogP | 6.34 |
| TPSA | 117.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |