C21H22ClN7O3 — CID 139486454
3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-(dimethylamino)-5-methylimidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 139486454) has the molecular formula C21H22ClN7O3 and a molecular weight of 455.91 g/mol. Its IUPAC name is 3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-(dimethylamino)-5-methylimidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-(dimethylamino)-5-methylimidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 139486454 |
| Molecular Formula | C21H22ClN7O3 |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-7-(dimethylamino)-5-methylimidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1nc(N(C)C)n2ncn(Cc3nc([C@@H]4CO[C@@H](c5ccc(Cl)cc5)C4)no3)c(=O)c12 |
| InChI | InChI=1S/C21H22ClN7O3/c1-12-18-20(30)28(11-23-29(18)21(24-12)27(2)3)9-17-25-19(26-32-17)14-8-16(31-10-14)13-4-6-15(22)7-5-13/h4-7,11,14,16H,8-10H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | XAPDVOAYLTUITQ-GOEBONIOSA-N |
| XLogP | 2.60 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |