C13H12Cl2N2O2 — CID 176544804
5-(chloromethyl)-3-[(3S,5S)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazole (PubChem CID 176544804) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 5-(chloromethyl)-3-[(3S,5S)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-(chloromethyl)-3-[(3S,5S)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 176544804 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 5-(chloromethyl)-3-[(3S,5S)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazole |
| SMILES | ClCc1nc([C@H]2CO[C@H](c3ccc(Cl)cc3)C2)no1 |
| InChI | InChI=1S/C13H12Cl2N2O2/c14-6-12-16-13(17-19-12)9-5-11(18-7-9)8-1-3-10(15)4-2-8/h1-4,9,11H,5-7H2/t9-,11+/m1/s1 |
| InChIKey | QBIDONBCDUEILJ-KOLCDFICSA-N |
| XLogP | 3.71 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|