C20H20ClN5O4 — CID 155883549
7-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,8,9,9a-tetrahydropyrimido[1,2-c]pyrimidine-2,6-dione (PubChem CID 155883549) has the molecular formula C20H20ClN5O4 and a molecular weight of 429.86 g/mol. Its IUPAC name is 7-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,8,9,9a-tetrahydropyrimido[1,2-c]pyrimidine-2,6-dione.
| Compound Name | 7-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,8,9,9a-tetrahydropyrimido[1,2-c]pyrimidine-2,6-dione |
|---|---|
| PubChem CID | 155883549 |
| Molecular Formula | C20H20ClN5O4 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 7-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,8,9,9a-tetrahydropyrimido[1,2-c]pyrimidine-2,6-dione |
| SMILES | O=C1C=CN2C(=O)N(Cc3nc([C@@H]4CO[C@@H](c5ccc(Cl)cc5)C4)no3)CCC2N1 |
| InChI | InChI=1S/C20H20ClN5O4/c21-14-3-1-12(2-4-14)15-9-13(11-29-15)19-23-18(30-24-19)10-25-7-5-16-22-17(27)6-8-26(16)20(25)28/h1-4,6,8,13,15-16H,5,7,9-11H2,(H,22,27)/t13-,15+,16?/m0/s1 |
| InChIKey | ZOVLCRMCXORKMD-GVJPCGBOSA-N |
| XLogP | 2.57 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |