C18H22N6O3 — CID 153432388
1-[[3-[(3S,5S)-5-phenyloxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-3,4,5,7,8,9-hexahydro-2H-purin-6-one (PubChem CID 153432388) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-[[3-[(3S,5S)-5-phenyloxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-3,4,5,7,8,9-hexahydro-2H-purin-6-one.
| Compound Name | 1-[[3-[(3S,5S)-5-phenyloxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-3,4,5,7,8,9-hexahydro-2H-purin-6-one |
|---|---|
| PubChem CID | 153432388 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-[[3-[(3S,5S)-5-phenyloxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-3,4,5,7,8,9-hexahydro-2H-purin-6-one |
| SMILES | O=C1C2NCNC2NCN1Cc1nc([C@H]2CO[C@H](c3ccccc3)C2)no1 |
| InChI | InChI=1S/C18H22N6O3/c25-18-15-17(20-9-19-15)21-10-24(18)7-14-22-16(23-27-14)12-6-13(26-8-12)11-4-2-1-3-5-11/h1-5,12-13,15,17,19-21H,6-10H2/t12-,13+,15?,17?/m1/s1 |
| InChIKey | SVSMZLYUCKYFBI-HGDLATOJSA-N |
| XLogP | 0.05 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |