C12H8ClN3O3 — CID 139488020
1-[(6-chloro-1-benzofuran-2-yl)methyl]triazole-4-carboxylic acid (PubChem CID 139488020) has the molecular formula C12H8ClN3O3 and a molecular weight of 277.67 g/mol. Its IUPAC name is 1-[(6-chloro-1-benzofuran-2-yl)methyl]triazole-4-carboxylic acid.
| Compound Name | 1-[(6-chloro-1-benzofuran-2-yl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 139488020 |
| Molecular Formula | C12H8ClN3O3 |
| Molecular Weight | 277.67 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 1-[(6-chloro-1-benzofuran-2-yl)methyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2cc3ccc(Cl)cc3o2)nn1 |
| InChI | InChI=1S/C12H8ClN3O3/c13-8-2-1-7-3-9(19-11(7)4-8)5-16-6-10(12(17)18)14-15-16/h1-4,6H,5H2,(H,17,18) |
| InChIKey | GRVJJQNFUTVYIZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |