C16H10O2 — CID 139489541
2,5-dihydropyrene-1,4-dione (PubChem CID 139489541) has the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2,5-dihydropyrene-1,4-dione.
| Compound Name | 2,5-dihydropyrene-1,4-dione |
|---|---|
| PubChem CID | 139489541 |
| Molecular Formula | C16H10O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2,5-dihydropyrene-1,4-dione |
| SMILES | O=C1Cc2cccc3ccc4c(c23)C1=CCC4=O |
| InChI | InChI=1S/C16H10O2/c17-13-7-6-12-14(18)8-10-3-1-2-9-4-5-11(13)16(12)15(9)10/h1-6H,7-8H2 |
| InChIKey | IBRMVWCIQCFXTM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |