C12H29N3 — CID 139489838
azane;3,7-diethyl-5-methyl-1-azabicyclo[3.2.1]octane (PubChem CID 139489838) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is azane;3,7-diethyl-5-methyl-1-azabicyclo[3.2.1]octane.
| Compound Name | azane;3,7-diethyl-5-methyl-1-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 139489838 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | azane;3,7-diethyl-5-methyl-1-azabicyclo[3.2.1]octane |
| SMILES | CCC1CN2CC(C)(C1)CC2CC.N.N |
| InChI | InChI=1S/C12H23N.2H3N/c1-4-10-6-12(3)7-11(5-2)13(8-10)9-12;;/h10-11H,4-9H2,1-3H3;2*1H3 |
| InChIKey | LAKIWQWZKFAMTE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |