C19H39N — CID 123697519
2,6-diethyl-1,4,4,8,8,10-hexamethylazecane (PubChem CID 123697519) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is 2,6-diethyl-1,4,4,8,8,10-hexamethylazecane.
| Compound Name | 2,6-diethyl-1,4,4,8,8,10-hexamethylazecane |
|---|---|
| PubChem CID | 123697519 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | 2,6-diethyl-1,4,4,8,8,10-hexamethylazecane |
| SMILES | CCC1CC(C)(C)CC(C)N(C)C(CC)CC(C)(C)C1 |
| InChI | InChI=1S/C19H39N/c1-9-16-12-18(4,5)11-15(3)20(8)17(10-2)14-19(6,7)13-16/h15-17H,9-14H2,1-8H3 |
| InChIKey | NBKZWPDCXWHZBO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |