C11H22N+ — CID 123400592
3-ethyl-1,5-dimethyl-1-azoniabicyclo[3.2.1]octane (PubChem CID 123400592) has the molecular formula C11H22N+ and a molecular weight of 168.30 g/mol. Its IUPAC name is 3-ethyl-1,5-dimethyl-1-azoniabicyclo[3.2.1]octane.
| Compound Name | 3-ethyl-1,5-dimethyl-1-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 123400592 |
| Molecular Formula | C11H22N+ |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.17 |
| IUPAC Name | 3-ethyl-1,5-dimethyl-1-azoniabicyclo[3.2.1]octane |
| SMILES | CCC1CC2(C)CC[N+](C)(C1)C2 |
| InChI | InChI=1S/C11H22N/c1-4-10-7-11(2)5-6-12(3,8-10)9-11/h10H,4-9H2,1-3H3/q+1 |
| InChIKey | UEVTULBNONWWBQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|