C18H25NO3 — CID 139492341
(NE)-N-(4,5-dimethoxy-1-methyl-15-tricyclo[7.5.1.02,7]pentadeca-2,4,6-trienylidene)hydroxylamine (PubChem CID 139492341) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (NE)-N-(4,5-dimethoxy-1-methyl-15-tricyclo[7.5.1.02,7]pentadeca-2,4,6-trienylidene)hydroxylamine.
| Compound Name | (NE)-N-(4,5-dimethoxy-1-methyl-15-tricyclo[7.5.1.02,7]pentadeca-2,4,6-trienylidene)hydroxylamine |
|---|---|
| PubChem CID | 139492341 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (NE)-N-(4,5-dimethoxy-1-methyl-15-tricyclo[7.5.1.02,7]pentadeca-2,4,6-trienylidene)hydroxylamine |
| SMILES | COc1cc2c(cc1OC)C1(C)CCCCCC(C2)/C1=N\O |
| InChI | InChI=1S/C18H25NO3/c1-18-8-6-4-5-7-12(17(18)19-20)9-13-10-15(21-2)16(22-3)11-14(13)18/h10-12,20H,4-9H2,1-3H3/b19-17+ |
| InChIKey | JLYXZJRGVXXOKW-HTXNQAPBSA-N |
| XLogP | 3.93 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|