C22H20F2N6O — CID 139496084
2-[5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-5-propan-2-yl-1,3,4-oxadiazole (PubChem CID 139496084) has the molecular formula C22H20F2N6O and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-[5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-5-propan-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-[5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-5-propan-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 139496084 |
| Molecular Formula | C22H20F2N6O |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-5-propan-2-yl-1,3,4-oxadiazole |
| SMILES | CC(C)c1nnc(-c2cnn3ccc(N4CC[C@H]5C[C@]54c4cc(F)ccc4F)nc23)o1 |
| InChI | InChI=1S/C22H20F2N6O/c1-12(2)20-27-28-21(31-20)15-11-25-30-8-6-18(26-19(15)30)29-7-5-13-10-22(13,29)16-9-14(23)3-4-17(16)24/h3-4,6,8-9,11-13H,5,7,10H2,1-2H3/t13-,22+/m0/s1 |
| InChIKey | BKPFJVIZLXNXOU-WHEQGISXSA-N |
| XLogP | 4.31 |
| TPSA | 72.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |