C24H23F2N7OS — CID 155771744
5-tert-butyl-N-[5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 155771744) has the molecular formula C24H23F2N7OS and a molecular weight of 495.56 g/mol. Its IUPAC name is 5-tert-butyl-N-[5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-tert-butyl-N-[5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 155771744 |
| Molecular Formula | C24H23F2N7OS |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 5-tert-butyl-N-[5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CC(C)(C)c1nnc(C(=O)Nc2cnn3ccc(N4CC[C@H]5C[C@]54c4cc(F)ccc4F)nc23)s1 |
| InChI | InChI=1S/C24H23F2N7OS/c1-23(2,3)22-31-30-21(35-22)20(34)28-17-12-27-33-9-7-18(29-19(17)33)32-8-6-13-11-24(13,32)15-10-14(25)4-5-16(15)26/h4-5,7,9-10,12-13H,6,8,11H2,1-3H3,(H,28,34)/t13-,24+/m0/s1 |
| InChIKey | IRYWOMFYPBFIHB-RKNYENMMSA-N |
| XLogP | 4.53 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |