C17H13F2N5O2 — CID 155674461
5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]-3-nitropyrazolo[1,5-a]pyrimidine (PubChem CID 155674461) has the molecular formula C17H13F2N5O2 and a molecular weight of 357.32 g/mol. Its IUPAC name is 5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]-3-nitropyrazolo[1,5-a]pyrimidine.
| Compound Name | 5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]-3-nitropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 155674461 |
| Molecular Formula | C17H13F2N5O2 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 5-[(1R,5S)-1-(2,5-difluorophenyl)-2-azabicyclo[3.1.0]hexan-2-yl]-3-nitropyrazolo[1,5-a]pyrimidine |
| SMILES | O=[N+]([O-])c1cnn2ccc(N3CC[C@H]4C[C@]43c3cc(F)ccc3F)nc12 |
| InChI | InChI=1S/C17H13F2N5O2/c18-11-1-2-13(19)12(7-11)17-8-10(17)3-5-22(17)15-4-6-23-16(21-15)14(9-20-23)24(25)26/h1-2,4,6-7,9-10H,3,5,8H2/t10-,17+/m0/s1 |
| InChIKey | TXBVOMYJWFYTRC-DYZYQPBXSA-N |
| XLogP | 3.04 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|