C10H15N5O2 — CID 139498759
1-[(Z)-2-(dimethylamino)-3-(ethenylamino)prop-2-enyl]triazole-4-carboxylic acid (PubChem CID 139498759) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-[(Z)-2-(dimethylamino)-3-(ethenylamino)prop-2-enyl]triazole-4-carboxylic acid.
| Compound Name | 1-[(Z)-2-(dimethylamino)-3-(ethenylamino)prop-2-enyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 139498759 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-[(Z)-2-(dimethylamino)-3-(ethenylamino)prop-2-enyl]triazole-4-carboxylic acid |
| SMILES | C=CN/C=C(/Cn1cc(C(=O)O)nn1)N(C)C |
| InChI | InChI=1S/C10H15N5O2/c1-4-11-5-8(14(2)3)6-15-7-9(10(16)17)12-13-15/h4-5,7,11H,1,6H2,2-3H3,(H,16,17)/b8-5- |
| InChIKey | LNWMLGIPKCZRBQ-YVMONPNESA-N |
| XLogP | 0.11 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |