C12H19N5O2 — CID 155180320
ethyl 1-[(Z)-3-(ethenylamino)-2-(ethylamino)prop-2-enyl]triazole-4-carboxylate (PubChem CID 155180320) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is ethyl 1-[(Z)-3-(ethenylamino)-2-(ethylamino)prop-2-enyl]triazole-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-3-(ethenylamino)-2-(ethylamino)prop-2-enyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 155180320 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | ethyl 1-[(Z)-3-(ethenylamino)-2-(ethylamino)prop-2-enyl]triazole-4-carboxylate |
| SMILES | C=CN/C=C(/Cn1cc(C(=O)OCC)nn1)NCC |
| InChI | InChI=1S/C12H19N5O2/c1-4-13-7-10(14-5-2)8-17-9-11(15-16-17)12(18)19-6-3/h4,7,9,13-14H,1,5-6,8H2,2-3H3/b10-7- |
| InChIKey | BKMGIIIJCZJUEM-YFHOEESVSA-N |
| XLogP | 0.64 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |