C27H30N6O2S2 — CID 139499380
N-[5-[5-[5-[(3-benzyloxiran-2-yl)amino]-1,3,4-thiadiazol-2-yl]hexan-2-yl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 139499380) has the molecular formula C27H30N6O2S2 and a molecular weight of 534.71 g/mol. Its IUPAC name is N-[5-[5-[5-[(3-benzyloxiran-2-yl)amino]-1,3,4-thiadiazol-2-yl]hexan-2-yl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-[5-[5-[(3-benzyloxiran-2-yl)amino]-1,3,4-thiadiazol-2-yl]hexan-2-yl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 139499380 |
| Molecular Formula | C27H30N6O2S2 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | N-[5-[5-[5-[(3-benzyloxiran-2-yl)amino]-1,3,4-thiadiazol-2-yl]hexan-2-yl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | CC(CCC(C)c1nnc(NC2OC2Cc2ccccc2)s1)c1nnc(NC(=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C27H30N6O2S2/c1-17(24-30-32-26(36-24)28-22(34)16-20-11-7-4-8-12-20)13-14-18(2)25-31-33-27(37-25)29-23-21(35-23)15-19-9-5-3-6-10-19/h3-12,17-18,21,23H,13-16H2,1-2H3,(H,29,33)(H,28,32,34) |
| InChIKey | UIWXWTUGUFAHPF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|