C28H30N4O2 — CID 139507928
ethyl 2-[4-(3-benzhydrylbenzimidazol-5-yl)piperazin-1-yl]acetate (PubChem CID 139507928) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is ethyl 2-[4-(3-benzhydrylbenzimidazol-5-yl)piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-(3-benzhydrylbenzimidazol-5-yl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 139507928 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | ethyl 2-[4-(3-benzhydrylbenzimidazol-5-yl)piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(c2ccc3ncn(C(c4ccccc4)c4ccccc4)c3c2)CC1 |
| InChI | InChI=1S/C28H30N4O2/c1-2-34-27(33)20-30-15-17-31(18-16-30)24-13-14-25-26(19-24)32(21-29-25)28(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-14,19,21,28H,2,15-18,20H2,1H3 |
| InChIKey | LWOANISGZZMICD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |