C28H33N5O2S — CID 139507935
N-[3-[4-(3-benzhydrylbenzimidazol-5-yl)piperazin-1-yl]propyl]methanesulfonamide (PubChem CID 139507935) has the molecular formula C28H33N5O2S and a molecular weight of 503.67 g/mol. Its IUPAC name is N-[3-[4-(3-benzhydrylbenzimidazol-5-yl)piperazin-1-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[4-(3-benzhydrylbenzimidazol-5-yl)piperazin-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 139507935 |
| Molecular Formula | C28H33N5O2S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-[3-[4-(3-benzhydrylbenzimidazol-5-yl)piperazin-1-yl]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCN1CCN(c2ccc3ncn(C(c4ccccc4)c4ccccc4)c3c2)CC1 |
| InChI | InChI=1S/C28H33N5O2S/c1-36(34,35)30-15-8-16-31-17-19-32(20-18-31)25-13-14-26-27(21-25)33(22-29-26)28(23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-7,9-14,21-22,28,30H,8,15-20H2,1H3 |
| InChIKey | GMMJXLKHVSJRKK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|