C15H13FN2O2 — CID 139509915
1-(6-fluoroquinoline-4-carbonyl)piperidin-4-one (PubChem CID 139509915) has the molecular formula C15H13FN2O2 and a molecular weight of 272.28 g/mol. Its IUPAC name is 1-(6-fluoroquinoline-4-carbonyl)piperidin-4-one.
| Compound Name | 1-(6-fluoroquinoline-4-carbonyl)piperidin-4-one |
|---|---|
| PubChem CID | 139509915 |
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(6-fluoroquinoline-4-carbonyl)piperidin-4-one |
| SMILES | O=C1CCN(C(=O)c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C15H13FN2O2/c16-10-1-2-14-13(9-10)12(3-6-17-14)15(20)18-7-4-11(19)5-8-18/h1-3,6,9H,4-5,7-8H2 |
| InChIKey | NWHKGVZGUWCZCX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |