C17H13ClN2O3 — CID 139509999
N-(4-chlorophenyl)-2,5-dioxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 139509999) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.76 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,5-dioxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2,5-dioxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 139509999 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-(4-chlorophenyl)-2,5-dioxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C1NC(=O)C(c2ccccc2)C1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClN2O3/c18-11-6-8-12(9-7-11)19-16(22)14-13(15(21)20-17(14)23)10-4-2-1-3-5-10/h1-9,13-14H,(H,19,22)(H,20,21,23) |
| InChIKey | SKKUUGSYFCKHMM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|