C20H24FNO — CID 139510278
4-[[3-(2-fluoroethoxy)phenyl]-phenylmethyl]piperidine (PubChem CID 139510278) has the molecular formula C20H24FNO and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-[[3-(2-fluoroethoxy)phenyl]-phenylmethyl]piperidine.
| Compound Name | 4-[[3-(2-fluoroethoxy)phenyl]-phenylmethyl]piperidine |
|---|---|
| PubChem CID | 139510278 |
| Molecular Formula | C20H24FNO |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-[[3-(2-fluoroethoxy)phenyl]-phenylmethyl]piperidine |
| SMILES | FCCOc1cccc(C(c2ccccc2)C2CCNCC2)c1 |
| InChI | InChI=1S/C20H24FNO/c21-11-14-23-19-8-4-7-18(15-19)20(16-5-2-1-3-6-16)17-9-12-22-13-10-17/h1-8,15,17,20,22H,9-14H2 |
| InChIKey | ZKDTTWGCDPKQEI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |