About 4-benzhydrylpiperidine;hexan-1-ol
4-benzhydrylpiperidine;hexan-1-ol (PubChem CID 174445924) has the molecular formula C24H35NO
and a molecular weight of 353.55 g/mol. Its IUPAC name is 4-benzhydrylpiperidine;hexan-1-ol.
Molecular Properties
| Compound Name | 4-benzhydrylpiperidine;hexan-1-ol |
| PubChem CID | 174445924 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 4-benzhydrylpiperidine;hexan-1-ol |
| SMILES | CCCCCCO.c1ccc(C(c2ccccc2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C18H21N.C6H14O/c1-3-7-15(8-4-1)18(16-9-5-2-6-10-16)17-11-13-19-14-12-17;1-2-3-4-5-6-7/h1-10,17-19H,11-14H2;7H,2-6H2,1H3 |
| InChIKey | FMXOPQJWQKZDNP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-benzhydrylpiperidine;hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzhydrylpiperidine;hexan-1-ol?
The IUPAC name of 4-benzhydrylpiperidine;hexan-1-ol (CID 174445924) is 4-benzhydrylpiperidine;hexan-1-ol.
What is the SMILES notation for 4-benzhydrylpiperidine;hexan-1-ol?
The canonical SMILES for 4-benzhydrylpiperidine;hexan-1-ol is CCCCCCO.c1ccc(C(c2ccccc2)C2CCNCC2)cc1.
What is the InChIKey of 4-benzhydrylpiperidine;hexan-1-ol?
The InChIKey is FMXOPQJWQKZDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N.C6H14O/c1-3-7-15(8-4-1)18(16-9-5-2-6-10-16)17-11-13-19-14-12-17;1-2-3-4-5-6-7/h1-10,17-19H,11-14H2;7H,2-6H2,1H3.
What are the key properties of 4-benzhydrylpiperidine;hexan-1-ol?
4-benzhydrylpiperidine;hexan-1-ol has a molecular weight of 353.55 g/mol, XLogP of 5.38, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzhydrylpiperidine;hexan-1-ol is sourced from PubChem (CID 174445924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).