C28H34FN3O4 — CID 139517867
(4aR)-6-[4-[(S)-[3-(2-fluoroethoxy)phenyl]-phenylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 139517867) has the molecular formula C28H34FN3O4 and a molecular weight of 495.60 g/mol. Its IUPAC name is (4aR)-6-[4-[(S)-[3-(2-fluoroethoxy)phenyl]-phenylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR)-6-[4-[(S)-[3-(2-fluoroethoxy)phenyl]-phenylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 139517867 |
| Molecular Formula | C28H34FN3O4 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | (4aR)-6-[4-[(S)-[3-(2-fluoroethoxy)phenyl]-phenylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1COC2CCN(C(=O)N3CCC([C@@H](c4ccccc4)c4cccc(OCCF)c4)CC3)C[C@H]2N1 |
| InChI | InChI=1S/C28H34FN3O4/c29-12-16-35-23-8-4-7-22(17-23)27(20-5-2-1-3-6-20)21-9-13-31(14-10-21)28(34)32-15-11-25-24(18-32)30-26(33)19-36-25/h1-8,17,21,24-25,27H,9-16,18-19H2,(H,30,33)/t24-,25?,27-/m1/s1 |
| InChIKey | WGDIGGJBSQRWSF-PTYBVJFYSA-N |
| XLogP | 3.59 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |