C20H23F4N3O4 — CID 139517550
(4aR)-6-[3-[(4-fluorophenyl)-(2,2,2-trifluoroethoxy)methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 139517550) has the molecular formula C20H23F4N3O4 and a molecular weight of 445.41 g/mol. Its IUPAC name is (4aR)-6-[3-[(4-fluorophenyl)-(2,2,2-trifluoroethoxy)methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR)-6-[3-[(4-fluorophenyl)-(2,2,2-trifluoroethoxy)methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 139517550 |
| Molecular Formula | C20H23F4N3O4 |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (4aR)-6-[3-[(4-fluorophenyl)-(2,2,2-trifluoroethoxy)methyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1COC2CCN(C(=O)N3CC(C(OCC(F)(F)F)c4ccc(F)cc4)C3)C[C@H]2N1 |
| InChI | InChI=1S/C20H23F4N3O4/c21-14-3-1-12(2-4-14)18(31-11-20(22,23)24)13-7-27(8-13)19(29)26-6-5-16-15(9-26)25-17(28)10-30-16/h1-4,13,15-16,18H,5-11H2,(H,25,28)/t15-,16?,18?/m1/s1 |
| InChIKey | DVOVMSXLNDBATG-KLHKWILBSA-N |
| XLogP | 2.09 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |