C33H45N5O6 — CID 164820093
N-[2-[3-[(R)-[1-[(4aR,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl]piperidin-4-yl]-phenylmethyl]phenoxy]ethyl]-3-(2-aminoethoxy)propanamide (PubChem CID 164820093) has the molecular formula C33H45N5O6 and a molecular weight of 607.75 g/mol. Its IUPAC name is N-[2-[3-[(R)-[1-[(4aR,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl]piperidin-4-yl]-phenylmethyl]phenoxy]ethyl]-3-(2-aminoethoxy)propanamide.
| Compound Name | N-[2-[3-[(R)-[1-[(4aR,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl]piperidin-4-yl]-phenylmethyl]phenoxy]ethyl]-3-(2-aminoethoxy)propanamide |
|---|---|
| PubChem CID | 164820093 |
| Molecular Formula | C33H45N5O6 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | N-[2-[3-[(R)-[1-[(4aR,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl]piperidin-4-yl]-phenylmethyl]phenoxy]ethyl]-3-(2-aminoethoxy)propanamide |
| SMILES | NCCOCCC(=O)NCCOc1cccc([C@@H](c2ccccc2)C2CCN(C(=O)N3CC[C@@H]4OCC(=O)N[C@@H]4C3)CC2)c1 |
| InChI | InChI=1S/C33H45N5O6/c34-13-19-42-18-12-30(39)35-14-20-43-27-8-4-7-26(21-27)32(24-5-2-1-3-6-24)25-9-15-37(16-10-25)33(41)38-17-11-29-28(22-38)36-31(40)23-44-29/h1-8,21,25,28-29,32H,9-20,22-23,34H2,(H,35,39)(H,36,40)/t28-,29+,32+/m1/s1 |
| InChIKey | DHUYUZJZJVDMFM-PRMIEGHPSA-N |
| XLogP | 2.10 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|