C37H51N3O7 — CID 165104430
(4aR,8aS)-6-[4-[(R)-[3-[6-[2-(2-aminoethoxy)ethoxy]-4-oxohexoxy]phenyl]-phenylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 165104430) has the molecular formula C37H51N3O7 and a molecular weight of 649.83 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-[(R)-[3-[6-[2-(2-aminoethoxy)ethoxy]-4-oxohexoxy]phenyl]-phenylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[4-[(R)-[3-[6-[2-(2-aminoethoxy)ethoxy]-4-oxohexoxy]phenyl]-phenylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 165104430 |
| Molecular Formula | C37H51N3O7 |
| Molecular Weight | 649.83 g/mol |
| Exact Mass | 649.37 |
| IUPAC Name | (4aR,8aS)-6-[4-[(R)-[3-[6-[2-(2-aminoethoxy)ethoxy]-4-oxohexoxy]phenyl]-phenylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | NCCOCCOCCC(=O)CCCOc1cccc(C(c2ccccc2)C2CCN(C(=O)N3CC[C@@H]4OCC(=O)C[C@@H]4C3)CC2)c1 |
| InChI | InChI=1S/C37H51N3O7/c38-15-21-45-23-22-44-20-14-32(41)9-5-19-46-34-10-4-8-30(25-34)36(28-6-2-1-3-7-28)29-11-16-39(17-12-29)37(43)40-18-13-35-31(26-40)24-33(42)27-47-35/h1-4,6-8,10,25,29,31,35-36H,5,9,11-24,26-27,38H2/t31-,35+,36?/m1/s1 |
| InChIKey | YWUQTHACKHMUND-CHJPYABQSA-N |
| XLogP | 4.44 |
| TPSA | 120.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|