C10H9ClF3NO — CID 139510289
3-[2-chloro-4-(trifluoromethoxy)phenyl]azetidine (PubChem CID 139510289) has the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. Its IUPAC name is 3-[2-chloro-4-(trifluoromethoxy)phenyl]azetidine.
| Compound Name | 3-[2-chloro-4-(trifluoromethoxy)phenyl]azetidine |
|---|---|
| PubChem CID | 139510289 |
| Molecular Formula | C10H9ClF3NO |
| Molecular Weight | 251.63 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 3-[2-chloro-4-(trifluoromethoxy)phenyl]azetidine |
| SMILES | FC(F)(F)Oc1ccc(C2CNC2)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClF3NO/c11-9-3-7(16-10(12,13)14)1-2-8(9)6-4-15-5-6/h1-3,6,15H,4-5H2 |
| InChIKey | HRFNFMILJKQAJG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |