C12H9ClF6O2 — CID 166158947
4-[2-chloro-4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)oxolane (PubChem CID 166158947) has the molecular formula C12H9ClF6O2 and a molecular weight of 334.64 g/mol. Its IUPAC name is 4-[2-chloro-4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)oxolane.
| Compound Name | 4-[2-chloro-4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 166158947 |
| Molecular Formula | C12H9ClF6O2 |
| Molecular Weight | 334.64 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 4-[2-chloro-4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)oxolane |
| SMILES | FC(F)(F)Oc1ccc(C2COC(C(F)(F)F)C2)c(Cl)c1 |
| InChI | InChI=1S/C12H9ClF6O2/c13-9-4-7(21-12(17,18)19)1-2-8(9)6-3-10(20-5-6)11(14,15)16/h1-2,4,6,10H,3,5H2 |
| InChIKey | RLTDNIBZPUURRN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |