C11H7Br2F3O2 — CID 11047353
(1S,8R,9R,10S)-9,10-dibromo-4-(trifluoromethoxy)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 11047353) has the molecular formula C11H7Br2F3O2 and a molecular weight of 387.98 g/mol. Its IUPAC name is (1S,8R,9R,10S)-9,10-dibromo-4-(trifluoromethoxy)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | (1S,8R,9R,10S)-9,10-dibromo-4-(trifluoromethoxy)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 11047353 |
| Molecular Formula | C11H7Br2F3O2 |
| Molecular Weight | 387.98 g/mol |
| Exact Mass | 385.88 |
| IUPAC Name | (1S,8R,9R,10S)-9,10-dibromo-4-(trifluoromethoxy)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | FC(F)(F)Oc1ccc2c(c1)[C@@H]1O[C@H]2[C@@H](Br)[C@H]1Br |
| InChI | InChI=1S/C11H7Br2F3O2/c12-7-8(13)10-6-3-4(18-11(14,15)16)1-2-5(6)9(7)17-10/h1-3,7-10H/t7-,8+,9+,10-/m0/s1 |
| InChIKey | YQZTXJVRMTZYRA-JLIMGVALSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|