C11H7F3O2 — CID 11075153
(1R,8S)-4-(trifluoromethoxy)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene (PubChem CID 11075153) has the molecular formula C11H7F3O2 and a molecular weight of 228.17 g/mol. Its IUPAC name is (1R,8S)-4-(trifluoromethoxy)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene.
| Compound Name | (1R,8S)-4-(trifluoromethoxy)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 11075153 |
| Molecular Formula | C11H7F3O2 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | (1R,8S)-4-(trifluoromethoxy)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
| SMILES | FC(F)(F)Oc1ccc2c(c1)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C11H7F3O2/c12-11(13,14)16-6-1-2-7-8(5-6)10-4-3-9(7)15-10/h1-5,9-10H/t9-,10+/m0/s1 |
| InChIKey | SLHWRTRCMPXMAM-VHSXEESVSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|