C10H7F3O2 — CID 142618085
4-(trifluoromethoxy)-6,6a-dihydro-1aH-indeno[1,2-b]oxirene (PubChem CID 142618085) has the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. Its IUPAC name is 4-(trifluoromethoxy)-6,6a-dihydro-1aH-indeno[1,2-b]oxirene.
| Compound Name | 4-(trifluoromethoxy)-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
|---|---|
| PubChem CID | 142618085 |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 4-(trifluoromethoxy)-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
| SMILES | FC(F)(F)Oc1ccc2c(c1)CC1OC21 |
| InChI | InChI=1S/C10H7F3O2/c11-10(12,13)15-6-1-2-7-5(3-6)4-8-9(7)14-8/h1-3,8-9H,4H2 |
| InChIKey | OBCHDPKRFRHASV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|