C18H22F3NO2 — CID 78144869
5-cyclopentyl-9-(trifluoromethoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 78144869) has the molecular formula C18H22F3NO2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 5-cyclopentyl-9-(trifluoromethoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | 5-cyclopentyl-9-(trifluoromethoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 78144869 |
| Molecular Formula | C18H22F3NO2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 5-cyclopentyl-9-(trifluoromethoxy)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | FC(F)(F)Oc1ccc2c(c1)C1OCCCC1C(C1CCCC1)N2 |
| InChI | InChI=1S/C18H22F3NO2/c19-18(20,21)24-12-7-8-15-14(10-12)17-13(6-3-9-23-17)16(22-15)11-4-1-2-5-11/h7-8,10-11,13,16-17,22H,1-6,9H2 |
| InChIKey | SSBXXMPAJWCARP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|