C15H16N2 — CID 139512300
5-[(3-cyclopropylphenyl)methyl]pyridin-2-amine (PubChem CID 139512300) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 5-[(3-cyclopropylphenyl)methyl]pyridin-2-amine.
| Compound Name | 5-[(3-cyclopropylphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 139512300 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 5-[(3-cyclopropylphenyl)methyl]pyridin-2-amine |
| SMILES | Nc1ccc(Cc2cccc(C3CC3)c2)cn1 |
| InChI | InChI=1S/C15H16N2/c16-15-7-4-12(10-17-15)8-11-2-1-3-14(9-11)13-5-6-13/h1-4,7,9-10,13H,5-6,8H2,(H2,16,17) |
| InChIKey | XSDWMGRDNQINOO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |