C12H14N2O6 — CID 139513216
butanoic acid;1-(2,5-dioxopyrrolidin-1-yl)pyrrole-2,5-dione (PubChem CID 139513216) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is butanoic acid;1-(2,5-dioxopyrrolidin-1-yl)pyrrole-2,5-dione.
| Compound Name | butanoic acid;1-(2,5-dioxopyrrolidin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139513216 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | butanoic acid;1-(2,5-dioxopyrrolidin-1-yl)pyrrole-2,5-dione |
| SMILES | CCCC(=O)O.O=C1C=CC(=O)N1N1C(=O)CCC1=O |
| InChI | InChI=1S/C8H6N2O4.C4H8O2/c11-5-1-2-6(12)9(5)10-7(13)3-4-8(10)14;1-2-3-4(5)6/h1-2H,3-4H2;2-3H2,1H3,(H,5,6) |
| InChIKey | PJORYWVELQWOTD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|