C10H12N2O6 — CID 161464096
acetic acid;pyrrole-2,5-dione;pyrrolidine-2,5-dione (PubChem CID 161464096) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is acetic acid;pyrrole-2,5-dione;pyrrolidine-2,5-dione.
| Compound Name | acetic acid;pyrrole-2,5-dione;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 161464096 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | acetic acid;pyrrole-2,5-dione;pyrrolidine-2,5-dione |
| SMILES | CC(=O)O.O=C1C=CC(=O)N1.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.C4H3NO2.C2H4O2/c2*6-3-1-2-4(7)5-3;1-2(3)4/h1-2H2,(H,5,6,7);1-2H,(H,5,6,7);1H3,(H,3,4) |
| InChIKey | WCEUTCKZSOOCAR-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|