C19H29N3O4S — CID 139516972
N-[2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl]-2-[2-(cyclobutylmethylamino)-2-oxoethyl]sulfanylacetamide (PubChem CID 139516972) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is N-[2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl]-2-[2-(cyclobutylmethylamino)-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-[2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl]-2-[2-(cyclobutylmethylamino)-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 139516972 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl]-2-[2-(cyclobutylmethylamino)-2-oxoethyl]sulfanylacetamide |
| SMILES | O=C(CSCC(=O)NCC1CCC1)NCCN1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C19H29N3O4S/c23-16(11-27-12-17(24)21-10-13-4-3-5-13)20-8-9-22-18(25)14-6-1-2-7-15(14)19(22)26/h13-15H,1-12H2,(H,20,23)(H,21,24)/t14-,15+ |
| InChIKey | KAWAKEHWSMYDPK-GASCZTMLSA-N |
| XLogP | 0.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|